C32H58O3 — CID 178009838
ethane;(2,5,8-trimethyl-3,4-dihydro-2H-chromen-6-yl) acetate;2,6,10-trimethyltridecane (PubChem CID 178009838) has the molecular formula C32H58O3 and a molecular weight of 490.81 g/mol. Its IUPAC name is ethane;(2,5,8-trimethyl-3,4-dihydro-2H-chromen-6-yl) acetate;2,6,10-trimethyltridecane.
| Compound Name | ethane;(2,5,8-trimethyl-3,4-dihydro-2H-chromen-6-yl) acetate;2,6,10-trimethyltridecane |
|---|---|
| PubChem CID | 178009838 |
| Molecular Formula | C32H58O3 |
| Molecular Weight | 490.81 g/mol |
| Exact Mass | 490.44 |
| IUPAC Name | ethane;(2,5,8-trimethyl-3,4-dihydro-2H-chromen-6-yl) acetate;2,6,10-trimethyltridecane |
| SMILES | CC.CC(=O)Oc1cc(C)c2c(c1C)CCC(C)O2.CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C16H34.C14H18O3.C2H6/c1-6-9-15(4)12-8-13-16(5)11-7-10-14(2)3;1-8-7-13(17-11(4)15)10(3)12-6-5-9(2)16-14(8)12;1-2/h14-16H,6-13H2,1-5H3;7,9H,5-6H2,1-4H3;1-2H3 |
| InChIKey | DEMIHHDZYHABRI-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.81 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|