About N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen
N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen (PubChem CID 178010181) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen |
| PubChem CID | 178010181 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen |
| SMILES | C/C=C/CNC(=O)CC1=NCCN=C1.CC.[H][H] |
| InChI | InChI=1S/C10H15N3O.C2H6.H2/c1-2-3-4-13-10(14)7-9-8-11-5-6-12-9;1-2;/h2-3,8H,4-7H2,1H3,(H,13,14);1-2H3;1H/b3-2+;; |
| InChIKey | NTEJVKOICOBUDL-WTVBWJGASA-N |
| XLogP | 1.87 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen?
The IUPAC name of N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen (CID 178010181) is N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen.
What is the SMILES notation for N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen?
The canonical SMILES for N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen is C/C=C/CNC(=O)CC1=NCCN=C1.CC.[H][H].
What is the InChIKey of N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen?
The InChIKey is NTEJVKOICOBUDL-WTVBWJGASA-N. The full InChI is InChI=1S/C10H15N3O.C2H6.H2/c1-2-3-4-13-10(14)7-9-8-11-5-6-12-9;1-2;/h2-3,8H,4-7H2,1H3,(H,13,14);1-2H3;1H/b3-2+;;.
What are the key properties of N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen?
N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen has a molecular weight of 225.34 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide;ethane;molecular hydrogen is sourced from PubChem (CID 178010181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).