About N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide
N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide (PubChem CID 178010182) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide |
| PubChem CID | 178010182 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide |
| SMILES | C/C=C/CNC(=O)CC1=NCCN=C1 |
| InChI | InChI=1S/C10H15N3O/c1-2-3-4-13-10(14)7-9-8-11-5-6-12-9/h2-3,8H,4-7H2,1H3,(H,13,14)/b3-2+ |
| InChIKey | MTMZCCWZURQHAP-NSCUHMNNSA-N |
| XLogP | 0.59 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide?
The IUPAC name of N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide (CID 178010182) is N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide.
What is the SMILES notation for N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide?
The canonical SMILES for N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide is C/C=C/CNC(=O)CC1=NCCN=C1.
What is the InChIKey of N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide?
The InChIKey is MTMZCCWZURQHAP-NSCUHMNNSA-N. The full InChI is InChI=1S/C10H15N3O/c1-2-3-4-13-10(14)7-9-8-11-5-6-12-9/h2-3,8H,4-7H2,1H3,(H,13,14)/b3-2+.
What are the key properties of N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide?
N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide has a molecular weight of 193.25 g/mol, XLogP of 0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]-2-(2,3-dihydropyrazin-5-yl)acetamide is sourced from PubChem (CID 178010182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).