About N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen
N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen (PubChem CID 178010416) has the molecular formula C12H27N3O
and a molecular weight of 229.37 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen |
| PubChem CID | 178010416 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen |
| SMILES | C/C=C/CNC(=O)C1CC(C)N(C)N1.CC.[H][H] |
| InChI | InChI=1S/C10H19N3O.C2H6.H2/c1-4-5-6-11-10(14)9-7-8(2)13(3)12-9;1-2;/h4-5,8-9,12H,6-7H2,1-3H3,(H,11,14);1-2H3;1H/b5-4+;; |
| InChIKey | GAZCAWWYDGVHMA-SFKRKKMESA-N |
| XLogP | 1.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen?
The IUPAC name of N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen (CID 178010416) is N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen.
What is the SMILES notation for N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen?
The canonical SMILES for N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen is C/C=C/CNC(=O)C1CC(C)N(C)N1.CC.[H][H].
What is the InChIKey of N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen?
The InChIKey is GAZCAWWYDGVHMA-SFKRKKMESA-N. The full InChI is InChI=1S/C10H19N3O.C2H6.H2/c1-4-5-6-11-10(14)9-7-8(2)13(3)12-9;1-2;/h4-5,8-9,12H,6-7H2,1-3H3,(H,11,14);1-2H3;1H/b5-4+;;.
What are the key properties of N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen?
N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen has a molecular weight of 229.37 g/mol, XLogP of 1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]-1,5-dimethylpyrazolidine-3-carboxamide;ethane;molecular hydrogen is sourced from PubChem (CID 178010416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).