About N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide
N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide (PubChem CID 178010743) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide |
| PubChem CID | 178010743 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide |
| SMILES | C/C=C/CNC(=O)C1COCCO1 |
| InChI | InChI=1S/C9H15NO3/c1-2-3-4-10-9(11)8-7-12-5-6-13-8/h2-3,8H,4-7H2,1H3,(H,10,11)/b3-2+ |
| InChIKey | NVJTWHLNTGEJEE-NSCUHMNNSA-N |
| XLogP | 0.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide?
The IUPAC name of N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide (CID 178010743) is N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide is C/C=C/CNC(=O)C1COCCO1.
What is the InChIKey of N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide?
The InChIKey is NVJTWHLNTGEJEE-NSCUHMNNSA-N. The full InChI is InChI=1S/C9H15NO3/c1-2-3-4-10-9(11)8-7-12-5-6-13-8/h2-3,8H,4-7H2,1H3,(H,10,11)/b3-2+.
What are the key properties of N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide?
N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide has a molecular weight of 185.22 g/mol, XLogP of 0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 178010743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).