About N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane
N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane (PubChem CID 178010819) has the molecular formula C14H29N3O
and a molecular weight of 255.41 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane |
| PubChem CID | 178010819 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane |
| SMILES | C/C=C/CNC(=O)CC(/C=N/C)=N/C.CC.CC |
| InChI | InChI=1S/C10H17N3O.2C2H6/c1-4-5-6-13-10(14)7-9(12-3)8-11-2;2*1-2/h4-5,8H,6-7H2,1-3H3,(H,13,14);2*1-2H3/b5-4+,11-8+,12-9-;; |
| InChIKey | MBHSSSLLJUHDQZ-INGZFVQBSA-N |
| XLogP | 2.89 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane?
The IUPAC name of N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane (CID 178010819) is N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane.
What is the SMILES notation for N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane?
The canonical SMILES for N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane is C/C=C/CNC(=O)CC(/C=N/C)=N/C.CC.CC.
What is the InChIKey of N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane?
The InChIKey is MBHSSSLLJUHDQZ-INGZFVQBSA-N. The full InChI is InChI=1S/C10H17N3O.2C2H6/c1-4-5-6-13-10(14)7-9(12-3)8-11-2;2*1-2/h4-5,8H,6-7H2,1-3H3,(H,13,14);2*1-2H3/b5-4+,11-8+,12-9-;;.
What are the key properties of N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane?
N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane has a molecular weight of 255.41 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]-3,4-bis(methylimino)butanamide;ethane is sourced from PubChem (CID 178010819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).