About CID 178010902
CID 178010902 (PubChem CID 178010902) has the molecular formula C9H13N3O3S+
and a molecular weight of 243.29 g/mol.
Molecular Properties
| Compound Name | CID 178010902 |
| PubChem CID | 178010902 |
| Molecular Formula | C9H13N3O3S+ |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | — |
| SMILES | C/C=C/CNC(=O)C1=C[CH][N+](S(C)(=O)=O)=N1 |
| InChI | InChI=1S/C9H13N3O3S/c1-3-4-6-10-9(13)8-5-7-12(11-8)16(2,14)15/h3-5,7H,6H2,1-2H3,(H,10,13)/q+1/b4-3+ |
| InChIKey | REEGRWMPLRADGY-ONEGZZNKSA-N |
| XLogP | 0.16 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 178010902 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178010902?
The IUPAC name of CID 178010902 (CID 178010902) is not available.
What is the SMILES notation for CID 178010902?
The canonical SMILES for CID 178010902 is C/C=C/CNC(=O)C1=C[CH][N+](S(C)(=O)=O)=N1.
What is the InChIKey of CID 178010902?
The InChIKey is REEGRWMPLRADGY-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-3-4-6-10-9(13)8-5-7-12(11-8)16(2,14)15/h3-5,7H,6H2,1-2H3,(H,10,13)/q+1/b4-3+.
What are the key properties of CID 178010902?
CID 178010902 has a molecular weight of 243.29 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178010902 is sourced from PubChem (CID 178010902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).