C9H18N2O2 — CID 178011182
N-[(E)-3-aminoprop-2-enyl]oxetane-2-carboxamide;ethane (PubChem CID 178011182) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is N-[(E)-3-aminoprop-2-enyl]oxetane-2-carboxamide;ethane.
| Compound Name | N-[(E)-3-aminoprop-2-enyl]oxetane-2-carboxamide;ethane |
|---|---|
| PubChem CID | 178011182 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N-[(E)-3-aminoprop-2-enyl]oxetane-2-carboxamide;ethane |
| SMILES | CC.N/C=C/CNC(=O)C1CCO1 |
| InChI | InChI=1S/C7H12N2O2.C2H6/c8-3-1-4-9-7(10)6-2-5-11-6;1-2/h1,3,6H,2,4-5,8H2,(H,9,10);1-2H3/b3-1+; |
| InChIKey | CIABIXAQNLSPJP-KSMVGCCESA-N |
| XLogP | 0.39 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |