About 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine
2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine (PubChem CID 178011559) has the molecular formula C9H17FN2
and a molecular weight of 172.25 g/mol. Its IUPAC name is 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine |
| PubChem CID | 178011559 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine |
| SMILES | C=C(C)NC1CCC(N)CC1F |
| InChI | InChI=1S/C9H17FN2/c1-6(2)12-9-4-3-7(11)5-8(9)10/h7-9,12H,1,3-5,11H2,2H3 |
| InChIKey | JWRQHMNHSMYUOM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine?
The IUPAC name of 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine (CID 178011559) is 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine.
What is the SMILES notation for 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine?
The canonical SMILES for 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine is C=C(C)NC1CCC(N)CC1F.
What is the InChIKey of 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine?
The InChIKey is JWRQHMNHSMYUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FN2/c1-6(2)12-9-4-3-7(11)5-8(9)10/h7-9,12H,1,3-5,11H2,2H3.
What are the key properties of 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine?
2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine has a molecular weight of 172.25 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-N-prop-1-en-2-ylcyclohexane-1,4-diamine is sourced from PubChem (CID 178011559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).