About N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane
N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane (PubChem CID 178011685) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane |
| PubChem CID | 178011685 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane |
| SMILES | C/C=C/CNC(=O)C1CC1(C)C.CC |
| InChI | InChI=1S/C10H17NO.C2H6/c1-4-5-6-11-9(12)8-7-10(8,2)3;1-2/h4-5,8H,6-7H2,1-3H3,(H,11,12);1-2H3/b5-4+; |
| InChIKey | YEXPSYUODKJVPB-FXRZFVDSSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane?
The IUPAC name of N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane (CID 178011685) is N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane.
What is the SMILES notation for N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane?
The canonical SMILES for N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane is C/C=C/CNC(=O)C1CC1(C)C.CC.
What is the InChIKey of N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane?
The InChIKey is YEXPSYUODKJVPB-FXRZFVDSSA-N. The full InChI is InChI=1S/C10H17NO.C2H6/c1-4-5-6-11-9(12)8-7-10(8,2)3;1-2/h4-5,8H,6-7H2,1-3H3,(H,11,12);1-2H3/b5-4+;.
What are the key properties of N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane?
N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane has a molecular weight of 197.32 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]-2,2-dimethylcyclopropane-1-carboxamide;ethane is sourced from PubChem (CID 178011685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).