C11H19NO — CID 178011838
3-tert-butyl-5,5-dimethyl-3,4-dihydropyridin-2-one (PubChem CID 178011838) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-tert-butyl-5,5-dimethyl-3,4-dihydropyridin-2-one.
| Compound Name | 3-tert-butyl-5,5-dimethyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 178011838 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-tert-butyl-5,5-dimethyl-3,4-dihydropyridin-2-one |
| SMILES | CC1(C)C=NC(=O)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C11H19NO/c1-10(2,3)8-6-11(4,5)7-12-9(8)13/h7-8H,6H2,1-5H3 |
| InChIKey | JUSGCEHNLNENJV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |