C10H17IN4O — CID 178012229
2-amino-3-(1-iodo-2,5,6,7-tetrahydro-1,4-diazepin-3-yl)-N,N-dimethylprop-2-enamide (PubChem CID 178012229) has the molecular formula C10H17IN4O and a molecular weight of 336.18 g/mol. Its IUPAC name is 2-amino-3-(1-iodo-2,5,6,7-tetrahydro-1,4-diazepin-3-yl)-N,N-dimethylprop-2-enamide.
| Compound Name | 2-amino-3-(1-iodo-2,5,6,7-tetrahydro-1,4-diazepin-3-yl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 178012229 |
| Molecular Formula | C10H17IN4O |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-amino-3-(1-iodo-2,5,6,7-tetrahydro-1,4-diazepin-3-yl)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)C(N)=CC1=NCCCN(I)C1 |
| InChI | InChI=1S/C10H17IN4O/c1-14(2)10(16)9(12)6-8-7-15(11)5-3-4-13-8/h6H,3-5,7,12H2,1-2H3 |
| InChIKey | VHKWKSGSGPCWOH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|