C14H20F2N2O2 — CID 178013346
1-[3-(difluoromethyl)-3-(4-methylpiperidine-1-carbonyl)azetidin-1-yl]prop-2-en-1-one (PubChem CID 178013346) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-3-(4-methylpiperidine-1-carbonyl)azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-(difluoromethyl)-3-(4-methylpiperidine-1-carbonyl)azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 178013346 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[3-(difluoromethyl)-3-(4-methylpiperidine-1-carbonyl)azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C(=O)N2CCC(C)CC2)(C(F)F)C1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-3-11(19)18-8-14(9-18,12(15)16)13(20)17-6-4-10(2)5-7-17/h3,10,12H,1,4-9H2,2H3 |
| InChIKey | CHKYTHMYGRYHSX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|