C25H35N3O5 — CID 178013364
tert-butyl (2R)-2,4,4-trimethyl-2-[2-nitro-6-[(1R)-1-pyridin-2-ylethoxy]anilino]pentanoate (PubChem CID 178013364) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl (2R)-2,4,4-trimethyl-2-[2-nitro-6-[(1R)-1-pyridin-2-ylethoxy]anilino]pentanoate.
| Compound Name | tert-butyl (2R)-2,4,4-trimethyl-2-[2-nitro-6-[(1R)-1-pyridin-2-ylethoxy]anilino]pentanoate |
|---|---|
| PubChem CID | 178013364 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | tert-butyl (2R)-2,4,4-trimethyl-2-[2-nitro-6-[(1R)-1-pyridin-2-ylethoxy]anilino]pentanoate |
| SMILES | C[C@@H](Oc1cccc([N+](=O)[O-])c1N[C@](C)(CC(C)(C)C)C(=O)OC(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C25H35N3O5/c1-17(18-12-9-10-15-26-18)32-20-14-11-13-19(28(30)31)21(20)27-25(8,16-23(2,3)4)22(29)33-24(5,6)7/h9-15,17,27H,16H2,1-8H3/t17-,25-/m1/s1 |
| InChIKey | HSNYPLWZTBUTES-CRICUBBOSA-N |
| XLogP | 6.08 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|