C28H31FN8O2 — CID 178013396
[4-[4-[1-cyclopropyl-7-[2-(5-fluoro-2-pyridinyl)-2-hydroxypropoxy]benzimidazol-5-yl]-5-methyltriazol-1-yl]cyclohexyl]cyanamide (PubChem CID 178013396) has the molecular formula C28H31FN8O2 and a molecular weight of 530.61 g/mol. Its IUPAC name is [4-[4-[1-cyclopropyl-7-[2-(5-fluoro-2-pyridinyl)-2-hydroxypropoxy]benzimidazol-5-yl]-5-methyltriazol-1-yl]cyclohexyl]cyanamide.
| Compound Name | [4-[4-[1-cyclopropyl-7-[2-(5-fluoro-2-pyridinyl)-2-hydroxypropoxy]benzimidazol-5-yl]-5-methyltriazol-1-yl]cyclohexyl]cyanamide |
|---|---|
| PubChem CID | 178013396 |
| Molecular Formula | C28H31FN8O2 |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | [4-[4-[1-cyclopropyl-7-[2-(5-fluoro-2-pyridinyl)-2-hydroxypropoxy]benzimidazol-5-yl]-5-methyltriazol-1-yl]cyclohexyl]cyanamide |
| SMILES | Cc1c(-c2cc(OCC(C)(O)c3ccc(F)cn3)c3c(c2)ncn3C2CC2)nnn1C1CCC(NC#N)CC1 |
| InChI | InChI=1S/C28H31FN8O2/c1-17-26(34-35-37(17)22-6-4-20(5-7-22)32-15-30)18-11-23-27(36(16-33-23)21-8-9-21)24(12-18)39-14-28(2,38)25-10-3-19(29)13-31-25/h3,10-13,16,20-22,32,38H,4-9,14H2,1-2H3 |
| InChIKey | VOPSLSGNMBVSGP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|