About (Z)-3-methoxyoct-4-ene-1,8-diamine
(Z)-3-methoxyoct-4-ene-1,8-diamine (PubChem CID 178014454) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is (Z)-3-methoxyoct-4-ene-1,8-diamine.
Molecular Properties
| Compound Name | (Z)-3-methoxyoct-4-ene-1,8-diamine |
| PubChem CID | 178014454 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (Z)-3-methoxyoct-4-ene-1,8-diamine |
| SMILES | COC(/C=C\CCCN)CCN |
| InChI | InChI=1S/C9H20N2O/c1-12-9(6-8-11)5-3-2-4-7-10/h3,5,9H,2,4,6-8,10-11H2,1H3/b5-3- |
| InChIKey | CXJLILQTJPDIHY-HYXAFXHYSA-N |
| XLogP | 0.65 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-methoxyoct-4-ene-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methoxyoct-4-ene-1,8-diamine?
The IUPAC name of (Z)-3-methoxyoct-4-ene-1,8-diamine (CID 178014454) is (Z)-3-methoxyoct-4-ene-1,8-diamine.
What is the SMILES notation for (Z)-3-methoxyoct-4-ene-1,8-diamine?
The canonical SMILES for (Z)-3-methoxyoct-4-ene-1,8-diamine is COC(/C=C\CCCN)CCN.
What is the InChIKey of (Z)-3-methoxyoct-4-ene-1,8-diamine?
The InChIKey is CXJLILQTJPDIHY-HYXAFXHYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-12-9(6-8-11)5-3-2-4-7-10/h3,5,9H,2,4,6-8,10-11H2,1H3/b5-3-.
What are the key properties of (Z)-3-methoxyoct-4-ene-1,8-diamine?
(Z)-3-methoxyoct-4-ene-1,8-diamine has a molecular weight of 172.27 g/mol, XLogP of 0.65, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methoxyoct-4-ene-1,8-diamine is sourced from PubChem (CID 178014454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).