C20H28N2O4 — CID 178015107
N,N-dimethyl-2-[4-(oxan-4-ylmethoxy)-1H-indol-3-yl]-2-oxoacetamide;ethane (PubChem CID 178015107) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(oxan-4-ylmethoxy)-1H-indol-3-yl]-2-oxoacetamide;ethane.
| Compound Name | N,N-dimethyl-2-[4-(oxan-4-ylmethoxy)-1H-indol-3-yl]-2-oxoacetamide;ethane |
|---|---|
| PubChem CID | 178015107 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N,N-dimethyl-2-[4-(oxan-4-ylmethoxy)-1H-indol-3-yl]-2-oxoacetamide;ethane |
| SMILES | CC.CN(C)C(=O)C(=O)c1c[nH]c2cccc(OCC3CCOCC3)c12 |
| InChI | InChI=1S/C18H22N2O4.C2H6/c1-20(2)18(22)17(21)13-10-19-14-4-3-5-15(16(13)14)24-11-12-6-8-23-9-7-12;1-2/h3-5,10,12,19H,6-9,11H2,1-2H3;1-2H3 |
| InChIKey | FPHBVPBLCRJPGY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|