C23H21N3O4 — CID 178016044
3-[(2-benzamido-3-phenylpropanoyl)amino]-N-hydroxybenzamide (PubChem CID 178016044) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-[(2-benzamido-3-phenylpropanoyl)amino]-N-hydroxybenzamide.
| Compound Name | 3-[(2-benzamido-3-phenylpropanoyl)amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 178016044 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-[(2-benzamido-3-phenylpropanoyl)amino]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1cccc(NC(=O)C(Cc2ccccc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21N3O4/c27-21(17-10-5-2-6-11-17)25-20(14-16-8-3-1-4-9-16)23(29)24-19-13-7-12-18(15-19)22(28)26-30/h1-13,15,20,30H,14H2,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | QNKMBEBFRZXQIG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|