About 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea
1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea (PubChem CID 178016756) has the molecular formula C18H17BrF2N2O2
and a molecular weight of 411.25 g/mol. Its IUPAC name is 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea |
| PubChem CID | 178016756 |
| Molecular Formula | C18H17BrF2N2O2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea |
| SMILES | C=C(C)C(F)(F)c1cc(NC(=O)Nc2ccccc2OC)ccc1Br |
| InChI | InChI=1S/C18H17BrF2N2O2/c1-11(2)18(20,21)13-10-12(8-9-14(13)19)22-17(24)23-15-6-4-5-7-16(15)25-3/h4-10H,1H2,2-3H3,(H2,22,23,24) |
| InChIKey | FCBMRRXUKNJEHG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea?
The IUPAC name of 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea (CID 178016756) is 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea.
What is the SMILES notation for 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea?
The canonical SMILES for 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea is C=C(C)C(F)(F)c1cc(NC(=O)Nc2ccccc2OC)ccc1Br.
What is the InChIKey of 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea?
The InChIKey is FCBMRRXUKNJEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrF2N2O2/c1-11(2)18(20,21)13-10-12(8-9-14(13)19)22-17(24)23-15-6-4-5-7-16(15)25-3/h4-10H,1H2,2-3H3,(H2,22,23,24).
What are the key properties of 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea?
1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea has a molecular weight of 411.25 g/mol, XLogP of 5.77, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-bromo-3-(1,1-difluoro-2-methylprop-2-enyl)phenyl]-3-(2-methoxyphenyl)urea is sourced from PubChem (CID 178016756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).