C16H31N3O2 — CID 178017263
3-methyl-3-[4-[2-methyl-2-(3-methylbutoxy)propyl]triazol-1-yl]butan-1-ol (PubChem CID 178017263) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 3-methyl-3-[4-[2-methyl-2-(3-methylbutoxy)propyl]triazol-1-yl]butan-1-ol.
| Compound Name | 3-methyl-3-[4-[2-methyl-2-(3-methylbutoxy)propyl]triazol-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 178017263 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 3-methyl-3-[4-[2-methyl-2-(3-methylbutoxy)propyl]triazol-1-yl]butan-1-ol |
| SMILES | CC(C)CCOC(C)(C)Cc1cn(C(C)(C)CCO)nn1 |
| InChI | InChI=1S/C16H31N3O2/c1-13(2)7-10-21-16(5,6)11-14-12-19(18-17-14)15(3,4)8-9-20/h12-13,20H,7-11H2,1-6H3 |
| InChIKey | YYULNAGYFXZDMJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |