About S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane
S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane (PubChem CID 178017466) has the molecular formula C15H23F2N3O2S
and a molecular weight of 347.43 g/mol. Its IUPAC name is S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane.
Molecular Properties
| Compound Name | S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane |
| PubChem CID | 178017466 |
| Molecular Formula | C15H23F2N3O2S |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane |
| SMILES | CC.CC(=O)SC1CCC(Nc2ncc(OC(F)F)cn2)CC1 |
| InChI | InChI=1S/C13H17F2N3O2S.C2H6/c1-8(19)21-11-4-2-9(3-5-11)18-13-16-6-10(7-17-13)20-12(14)15;1-2/h6-7,9,11-12H,2-5H2,1H3,(H,16,17,18);1-2H3 |
| InChIKey | MVEPCMWGCLHLAL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane?
The IUPAC name of S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane (CID 178017466) is S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane.
What is the SMILES notation for S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane?
The canonical SMILES for S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane is CC.CC(=O)SC1CCC(Nc2ncc(OC(F)F)cn2)CC1.
What is the InChIKey of S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane?
The InChIKey is MVEPCMWGCLHLAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2N3O2S.C2H6/c1-8(19)21-11-4-2-9(3-5-11)18-13-16-6-10(7-17-13)20-12(14)15;1-2/h6-7,9,11-12H,2-5H2,1H3,(H,16,17,18);1-2H3.
What are the key properties of S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane?
S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane has a molecular weight of 347.43 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]cyclohexyl] ethanethioate;ethane is sourced from PubChem (CID 178017466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).