C26H31N5O3S — CID 178018166
(3Z)-1-[4-(N-butylidenecarbamimidoyl)-2-hydroxyphenyl]-3-[3-(2-butyl-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 178018166) has the molecular formula C26H31N5O3S and a molecular weight of 493.63 g/mol. Its IUPAC name is (3Z)-1-[4-(N-butylidenecarbamimidoyl)-2-hydroxyphenyl]-3-[3-(2-butyl-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[4-(N-butylidenecarbamimidoyl)-2-hydroxyphenyl]-3-[3-(2-butyl-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 178018166 |
| Molecular Formula | C26H31N5O3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (3Z)-1-[4-(N-butylidenecarbamimidoyl)-2-hydroxyphenyl]-3-[3-(2-butyl-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | [H]/N=C(\N=C\CCC)c1ccc(NC(=O)/N=C2\SCC(=O)N2c2cc(C)ccc2CCCC)c(O)c1 |
| InChI | InChI=1S/C26H31N5O3S/c1-4-6-8-18-10-9-17(3)14-21(18)31-23(33)16-35-26(31)30-25(34)29-20-12-11-19(15-22(20)32)24(27)28-13-7-5-2/h9-15,27,32H,4-8,16H2,1-3H3,(H,29,34)/b27-24-,28-13+,30-26- |
| InChIKey | QTFJXJJPHAUADN-GCNATJIMSA-N |
| XLogP | 5.91 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|