C10H15BrN2O4 — CID 178018389
(E)-2-bromo-N-formyl-3-[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]prop-2-enamide (PubChem CID 178018389) has the molecular formula C10H15BrN2O4 and a molecular weight of 307.14 g/mol. Its IUPAC name is (E)-2-bromo-N-formyl-3-[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]prop-2-enamide.
| Compound Name | (E)-2-bromo-N-formyl-3-[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 178018389 |
| Molecular Formula | C10H15BrN2O4 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | (E)-2-bromo-N-formyl-3-[[5-(hydroxymethyl)oxolan-2-yl]-methylamino]prop-2-enamide |
| SMILES | CN(/C=C(/Br)C(=O)NC=O)C1CCC(CO)O1 |
| InChI | InChI=1S/C10H15BrN2O4/c1-13(4-8(11)10(16)12-6-15)9-3-2-7(5-14)17-9/h4,6-7,9,14H,2-3,5H2,1H3,(H,12,15,16)/b8-4+ |
| InChIKey | QNPGCRDIEJEZKG-XBXARRHUSA-N |
| XLogP | -0.08 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|