About formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol
formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol (PubChem CID 178018930) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol.
Molecular Properties
| Compound Name | formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol |
| PubChem CID | 178018930 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol |
| SMILES | C=O.CNCCCC(C)(CO)COCc1ccccc1 |
| InChI | InChI=1S/C15H25NO2.CH2O/c1-15(12-17,9-6-10-16-2)13-18-11-14-7-4-3-5-8-14;1-2/h3-5,7-8,16-17H,6,9-13H2,1-2H3;1H2 |
| InChIKey | SCQROJGHENQNPC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol?
The IUPAC name of formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol (CID 178018930) is formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol.
What is the SMILES notation for formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol?
The canonical SMILES for formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol is C=O.CNCCCC(C)(CO)COCc1ccccc1.
What is the InChIKey of formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol?
The InChIKey is SCQROJGHENQNPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2.CH2O/c1-15(12-17,9-6-10-16-2)13-18-11-14-7-4-3-5-8-14;1-2/h3-5,7-8,16-17H,6,9-13H2,1-2H3;1H2.
What are the key properties of formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol?
formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol has a molecular weight of 281.40 g/mol, XLogP of 2.02, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-methyl-5-(methylamino)-2-(phenylmethoxymethyl)pentan-1-ol is sourced from PubChem (CID 178018930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).