About 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol
1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol (PubChem CID 178019202) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol.
Molecular Properties
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol |
| PubChem CID | 178019202 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol |
| SMILES | OC(Cn1ccnc1)C1C=CC=CC1 |
| InChI | InChI=1S/C11H14N2O/c14-11(8-13-7-6-12-9-13)10-4-2-1-3-5-10/h1-4,6-7,9-11,14H,5,8H2 |
| InChIKey | UPDDWVWNBHFESQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol?
The IUPAC name of 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol (CID 178019202) is 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol.
What is the SMILES notation for 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol?
The canonical SMILES for 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol is OC(Cn1ccnc1)C1C=CC=CC1.
What is the InChIKey of 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol?
The InChIKey is UPDDWVWNBHFESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c14-11(8-13-7-6-12-9-13)10-4-2-1-3-5-10/h1-4,6-7,9-11,14H,5,8H2.
What are the key properties of 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol?
1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol has a molecular weight of 190.25 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-2,4-dien-1-yl-2-imidazol-1-ylethanol is sourced from PubChem (CID 178019202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).