C16H27F2NO4 — CID 178021188
diethyl 2-[(4,4-difluorocyclohexyl)amino]hexanedioate (PubChem CID 178021188) has the molecular formula C16H27F2NO4 and a molecular weight of 335.39 g/mol. Its IUPAC name is diethyl 2-[(4,4-difluorocyclohexyl)amino]hexanedioate.
| Compound Name | diethyl 2-[(4,4-difluorocyclohexyl)amino]hexanedioate |
|---|---|
| PubChem CID | 178021188 |
| Molecular Formula | C16H27F2NO4 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | diethyl 2-[(4,4-difluorocyclohexyl)amino]hexanedioate |
| SMILES | CCOC(=O)CCCC(NC1CCC(F)(F)CC1)C(=O)OCC |
| InChI | InChI=1S/C16H27F2NO4/c1-3-22-14(20)7-5-6-13(15(21)23-4-2)19-12-8-10-16(17,18)11-9-12/h12-13,19H,3-11H2,1-2H3 |
| InChIKey | KABMLLNYNMOQKO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |