About 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane
2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane (PubChem CID 178021231) has the molecular formula C15H27F4N
and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane.
Molecular Properties
| Compound Name | 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane |
| PubChem CID | 178021231 |
| Molecular Formula | C15H27F4N |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane |
| SMILES | CC.CNC1CC(F)(F)CCC1C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H21F4N.C2H6/c1-18-11-8-13(16,17)6-4-10(11)9-3-2-5-12(14,15)7-9;1-2/h9-11,18H,2-8H2,1H3;1-2H3 |
| InChIKey | YIYGSHKUCVKSQE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane?
The IUPAC name of 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane (CID 178021231) is 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane.
What is the SMILES notation for 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane?
The canonical SMILES for 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane is CC.CNC1CC(F)(F)CCC1C1CCCC(F)(F)C1.
What is the InChIKey of 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane?
The InChIKey is YIYGSHKUCVKSQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F4N.C2H6/c1-18-11-8-13(16,17)6-4-10(11)9-3-2-5-12(14,15)7-9;1-2/h9-11,18H,2-8H2,1H3;1-2H3.
What are the key properties of 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane?
2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane has a molecular weight of 297.38 g/mol, XLogP of 4.86, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluorocyclohexyl)-5,5-difluoro-N-methylcyclohexan-1-amine;ethane is sourced from PubChem (CID 178021231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).