About methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate
methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate (PubChem CID 178021233) has the molecular formula C12H18F2O2
and a molecular weight of 232.27 g/mol. Its IUPAC name is methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate |
| PubChem CID | 178021233 |
| Molecular Formula | C12H18F2O2 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(C(C)(C)C)CCC(F)(F)C1 |
| InChI | InChI=1S/C12H18F2O2/c1-11(2,3)9-5-6-12(13,14)7-8(9)10(15)16-4/h5-7H2,1-4H3 |
| InChIKey | HQOOFVJPXBWQTA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate?
The IUPAC name of methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate (CID 178021233) is methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate.
What is the SMILES notation for methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate?
The canonical SMILES for methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate is COC(=O)C1=C(C(C)(C)C)CCC(F)(F)C1.
What is the InChIKey of methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate?
The InChIKey is HQOOFVJPXBWQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2O2/c1-11(2,3)9-5-6-12(13,14)7-8(9)10(15)16-4/h5-7H2,1-4H3.
What are the key properties of methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate?
methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate has a molecular weight of 232.27 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-tert-butyl-5,5-difluorocyclohexene-1-carboxylate is sourced from PubChem (CID 178021233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).