About [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite
[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite (PubChem CID 178021325) has the molecular formula C10H15IOS
and a molecular weight of 310.20 g/mol. Its IUPAC name is [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite.
Molecular Properties
| Compound Name | [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite |
| PubChem CID | 178021325 |
| Molecular Formula | C10H15IOS |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite |
| SMILES | C=C(/C=C/C1CCCCC1)OSI |
| InChI | InChI=1S/C10H15IOS/c1-9(12-13-11)7-8-10-5-3-2-4-6-10/h7-8,10H,1-6H2/b8-7+ |
| InChIKey | ITBFXBJLADTUTM-BQYQJAHWSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite?
The IUPAC name of [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite (CID 178021325) is [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite.
What is the SMILES notation for [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite?
The canonical SMILES for [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite is C=C(/C=C/C1CCCCC1)OSI.
What is the InChIKey of [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite?
The InChIKey is ITBFXBJLADTUTM-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H15IOS/c1-9(12-13-11)7-8-10-5-3-2-4-6-10/h7-8,10H,1-6H2/b8-7+.
What are the key properties of [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite?
[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite has a molecular weight of 310.20 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]oxy thiohypoiodite is sourced from PubChem (CID 178021325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).