C25H29F4N3O2 — CID 178021619
2-[2-[(3aS,6aR)-5,5-difluoro-3a,6a-dimethyl-2,3,4,6-tetrahydro-1H-pentalen-2-yl]-5,5-difluorocyclohexyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 178021619) has the molecular formula C25H29F4N3O2 and a molecular weight of 479.52 g/mol. Its IUPAC name is 2-[2-[(3aS,6aR)-5,5-difluoro-3a,6a-dimethyl-2,3,4,6-tetrahydro-1H-pentalen-2-yl]-5,5-difluorocyclohexyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[2-[(3aS,6aR)-5,5-difluoro-3a,6a-dimethyl-2,3,4,6-tetrahydro-1H-pentalen-2-yl]-5,5-difluorocyclohexyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 178021619 |
| Molecular Formula | C25H29F4N3O2 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[2-[(3aS,6aR)-5,5-difluoro-3a,6a-dimethyl-2,3,4,6-tetrahydro-1H-pentalen-2-yl]-5,5-difluorocyclohexyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | C[C@@]12CC(C3CCC(F)(F)CC3c3cc(=O)c4c(C(N)=O)nccc4[nH]3)C[C@]1(C)CC(F)(F)C2 |
| InChI | InChI=1S/C25H29F4N3O2/c1-22-8-13(9-23(22,2)12-25(28,29)11-22)14-3-5-24(26,27)10-15(14)17-7-18(33)19-16(32-17)4-6-31-20(19)21(30)34/h4,6-7,13-15H,3,5,8-12H2,1-2H3,(H2,30,34)(H,32,33)/t13?,14?,15?,22-,23+ |
| InChIKey | JFTXNXASGDZJCL-OSHGYBECSA-N |
| XLogP | 5.39 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |