About ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol
ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol (PubChem CID 178022344) has the molecular formula C13H28O2
and a molecular weight of 216.36 g/mol. Its IUPAC name is ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol |
| PubChem CID | 178022344 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol |
| SMILES | CC.CCOC1(C)C[C@@H](O)CCC1(C)C |
| InChI | InChI=1S/C11H22O2.C2H6/c1-5-13-11(4)8-9(12)6-7-10(11,2)3;1-2/h9,12H,5-8H2,1-4H3;1-2H3/t9-,11?;/m0./s1 |
| InChIKey | MZRKCTWMPDJEEI-QMOSYVFLSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol?
The IUPAC name of ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol (CID 178022344) is ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol.
What is the SMILES notation for ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol?
The canonical SMILES for ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol is CC.CCOC1(C)C[C@@H](O)CCC1(C)C.
What is the InChIKey of ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol?
The InChIKey is MZRKCTWMPDJEEI-QMOSYVFLSA-N. The full InChI is InChI=1S/C11H22O2.C2H6/c1-5-13-11(4)8-9(12)6-7-10(11,2)3;1-2/h9,12H,5-8H2,1-4H3;1-2H3/t9-,11?;/m0./s1.
What are the key properties of ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol?
ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol has a molecular weight of 216.36 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1S)-3-ethoxy-3,4,4-trimethylcyclohexan-1-ol is sourced from PubChem (CID 178022344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).