About 6-bromo-4-chloro-1,2-benzothiazol-3-one
6-bromo-4-chloro-1,2-benzothiazol-3-one (PubChem CID 178022999) has the molecular formula C7H3BrClNOS
and a molecular weight of 264.53 g/mol. Its IUPAC name is 6-bromo-4-chloro-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 6-bromo-4-chloro-1,2-benzothiazol-3-one |
| PubChem CID | 178022999 |
| Molecular Formula | C7H3BrClNOS |
| Molecular Weight | 264.53 g/mol |
| Exact Mass | 262.88 |
| IUPAC Name | 6-bromo-4-chloro-1,2-benzothiazol-3-one |
| SMILES | O=c1[nH]sc2cc(Br)cc(Cl)c12 |
| InChI | InChI=1S/C7H3BrClNOS/c8-3-1-4(9)6-5(2-3)12-10-7(6)11/h1-2H,(H,10,11) |
| InChIKey | XMQWIXOMTSRNAA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-4-chloro-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-chloro-1,2-benzothiazol-3-one?
The IUPAC name of 6-bromo-4-chloro-1,2-benzothiazol-3-one (CID 178022999) is 6-bromo-4-chloro-1,2-benzothiazol-3-one.
What is the SMILES notation for 6-bromo-4-chloro-1,2-benzothiazol-3-one?
The canonical SMILES for 6-bromo-4-chloro-1,2-benzothiazol-3-one is O=c1[nH]sc2cc(Br)cc(Cl)c12.
What is the InChIKey of 6-bromo-4-chloro-1,2-benzothiazol-3-one?
The InChIKey is XMQWIXOMTSRNAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrClNOS/c8-3-1-4(9)6-5(2-3)12-10-7(6)11/h1-2H,(H,10,11).
What are the key properties of 6-bromo-4-chloro-1,2-benzothiazol-3-one?
6-bromo-4-chloro-1,2-benzothiazol-3-one has a molecular weight of 264.53 g/mol, XLogP of 3.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-chloro-1,2-benzothiazol-3-one is sourced from PubChem (CID 178022999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).