About 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine
3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine (PubChem CID 178023888) has the molecular formula C11H13N5
and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine.
Molecular Properties
| Compound Name | 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine |
| PubChem CID | 178023888 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine |
| SMILES | CC(N)CC#Cc1cnc2c(N)ccnn12 |
| InChI | InChI=1S/C11H13N5/c1-8(12)3-2-4-9-7-14-11-10(13)5-6-15-16(9)11/h5-8H,3,12-13H2,1H3 |
| InChIKey | ZCZIRNGGJNYQCA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine?
The IUPAC name of 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine (CID 178023888) is 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine.
What is the SMILES notation for 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine?
The canonical SMILES for 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine is CC(N)CC#Cc1cnc2c(N)ccnn12.
What is the InChIKey of 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine?
The InChIKey is ZCZIRNGGJNYQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5/c1-8(12)3-2-4-9-7-14-11-10(13)5-6-15-16(9)11/h5-8H,3,12-13H2,1H3.
What are the key properties of 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine?
3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine has a molecular weight of 215.26 g/mol, XLogP of 0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminopent-1-ynyl)imidazo[1,2-b]pyridazin-8-amine is sourced from PubChem (CID 178023888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).