About 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine
4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine (PubChem CID 178024563) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine.
Molecular Properties
| Compound Name | 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine |
| PubChem CID | 178024563 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine |
| SMILES | NCCC#Cc1cncc2[nH]ncc12 |
| InChI | InChI=1S/C10H10N4/c11-4-2-1-3-8-5-12-7-10-9(8)6-13-14-10/h5-7H,2,4,11H2,(H,13,14) |
| InChIKey | MIKHWNDEXHCAHF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine?
The IUPAC name of 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine (CID 178024563) is 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine.
What is the SMILES notation for 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine?
The canonical SMILES for 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine is NCCC#Cc1cncc2[nH]ncc12.
What is the InChIKey of 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine?
The InChIKey is MIKHWNDEXHCAHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c11-4-2-1-3-8-5-12-7-10-9(8)6-13-14-10/h5-7H,2,4,11H2,(H,13,14).
What are the key properties of 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine?
4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine has a molecular weight of 186.22 g/mol, XLogP of 0.66, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-pyrazolo[5,4-c]pyridin-4-yl)but-3-yn-1-amine is sourced from PubChem (CID 178024563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).