C25H24ClN6P — CID 178024787
N'-[3-chloro-16-(6-dimethylphosphanyl-3-pyridinyl)-10-ethyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,8,11,13(18),14,16-octaen-8-yl]methanimidamide (PubChem CID 178024787) has the molecular formula C25H24ClN6P and a molecular weight of 474.94 g/mol. Its IUPAC name is N'-[3-chloro-16-(6-dimethylphosphanyl-3-pyridinyl)-10-ethyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,8,11,13(18),14,16-octaen-8-yl]methanimidamide.
| Compound Name | N'-[3-chloro-16-(6-dimethylphosphanyl-3-pyridinyl)-10-ethyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,8,11,13(18),14,16-octaen-8-yl]methanimidamide |
|---|---|
| PubChem CID | 178024787 |
| Molecular Formula | C25H24ClN6P |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N'-[3-chloro-16-(6-dimethylphosphanyl-3-pyridinyl)-10-ethyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,8,11,13(18),14,16-octaen-8-yl]methanimidamide |
| SMILES | CCC1N=C(/N=C/N)c2cccc(Cl)c2-n2c1nc1ccc(-c3ccc(P(C)C)nc3)cc12 |
| InChI | InChI=1S/C25H24ClN6P/c1-4-19-25-31-20-10-8-15(16-9-11-22(28-13-16)33(2)3)12-21(20)32(25)23-17(6-5-7-18(23)26)24(30-19)29-14-27/h5-14,19H,4H2,1-3H3,(H2,27,29,30) |
| InChIKey | VUWQUOWJEGKMHM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 81.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|