About CID 178025915
CID 178025915 (PubChem CID 178025915) has the molecular formula C31H42B3FN6O3
and a molecular weight of 598.15 g/mol.
Molecular Properties
| Compound Name | CID 178025915 |
| PubChem CID | 178025915 |
| Molecular Formula | C31H42B3FN6O3 |
| Molecular Weight | 598.15 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | — |
| SMILES | CC12CCCN1CC(F)C2.[B]C([B])(O)N(c1nc(CC)nc2c1CCC(c1c([C@@H](C)CC)ccc(N)c1C#N)C2)C([B])(O)O |
| InChI | InChI=1S/C23H28B3N5O3.C8H14FN/c1-4-12(3)14-8-9-17(28)16(11-27)20(14)13-6-7-15-18(10-13)29-19(5-2)30-21(15)31(22(24,25)32)23(26,33)34;1-8-3-2-4-10(8)6-7(9)5-8/h8-9,12-13,32-34H,4-7,10,28H2,1-3H3;7H,2-6H2,1H3/t12-,13?;/m0./s1 |
| InChIKey | WKNXHWQXGHBIIB-NQJMHYHOSA-N |
| XLogP | 2.37 |
| TPSA | 142.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 598.15 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 178025915 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178025915?
The IUPAC name of CID 178025915 (CID 178025915) is not available.
What is the SMILES notation for CID 178025915?
The canonical SMILES for CID 178025915 is CC12CCCN1CC(F)C2.[B]C([B])(O)N(c1nc(CC)nc2c1CCC(c1c([C@@H](C)CC)ccc(N)c1C#N)C2)C([B])(O)O.
What is the InChIKey of CID 178025915?
The InChIKey is WKNXHWQXGHBIIB-NQJMHYHOSA-N. The full InChI is InChI=1S/C23H28B3N5O3.C8H14FN/c1-4-12(3)14-8-9-17(28)16(11-27)20(14)13-6-7-15-18(10-13)29-19(5-2)30-21(15)31(22(24,25)32)23(26,33)34;1-8-3-2-4-10(8)6-7(9)5-8/h8-9,12-13,32-34H,4-7,10,28H2,1-3H3;7H,2-6H2,1H3/t12-,13?;/m0./s1.
What are the key properties of CID 178025915?
CID 178025915 has a molecular weight of 598.15 g/mol, XLogP of 2.37, 7 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178025915 is sourced from PubChem (CID 178025915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).