C20H23NO4S — CID 178026568
N-(4,7-dimethyl-2-oxochromen-6-yl)-4-methylbenzenesulfonamide;ethane (PubChem CID 178026568) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is N-(4,7-dimethyl-2-oxochromen-6-yl)-4-methylbenzenesulfonamide;ethane.
| Compound Name | N-(4,7-dimethyl-2-oxochromen-6-yl)-4-methylbenzenesulfonamide;ethane |
|---|---|
| PubChem CID | 178026568 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-(4,7-dimethyl-2-oxochromen-6-yl)-4-methylbenzenesulfonamide;ethane |
| SMILES | CC.Cc1ccc(S(=O)(=O)Nc2cc3c(C)cc(=O)oc3cc2C)cc1 |
| InChI | InChI=1S/C18H17NO4S.C2H6/c1-11-4-6-14(7-5-11)24(21,22)19-16-10-15-12(2)9-18(20)23-17(15)8-13(16)3;1-2/h4-10,19H,1-3H3;1-2H3 |
| InChIKey | RWVKQJVLAWPAHW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|