About 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate
4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate (PubChem CID 178029798) has the molecular formula C17H23BrFN3O4
and a molecular weight of 432.29 g/mol. Its IUPAC name is 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate.
Molecular Properties
| Compound Name | 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate |
| PubChem CID | 178029798 |
| Molecular Formula | C17H23BrFN3O4 |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate |
| SMILES | CC(C)(C)OC(N)=O.NC(=O)c1cc(F)c(Br)cc1NC(=O)CC1CC1 |
| InChI | InChI=1S/C12H12BrFN2O2.C5H11NO2/c13-8-5-10(7(12(15)18)4-9(8)14)16-11(17)3-6-1-2-6;1-5(2,3)8-4(6)7/h4-6H,1-3H2,(H2,15,18)(H,16,17);1-3H3,(H2,6,7) |
| InChIKey | MUXHCHAMPYLRAX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate?
The IUPAC name of 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate (CID 178029798) is 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate.
What is the SMILES notation for 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate?
The canonical SMILES for 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate is CC(C)(C)OC(N)=O.NC(=O)c1cc(F)c(Br)cc1NC(=O)CC1CC1.
What is the InChIKey of 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate?
The InChIKey is MUXHCHAMPYLRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrFN2O2.C5H11NO2/c13-8-5-10(7(12(15)18)4-9(8)14)16-11(17)3-6-1-2-6;1-5(2,3)8-4(6)7/h4-6H,1-3H2,(H2,15,18)(H,16,17);1-3H3,(H2,6,7).
What are the key properties of 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate?
4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate has a molecular weight of 432.29 g/mol, XLogP of 3.31, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-[(2-cyclopropylacetyl)amino]-5-fluorobenzamide;tert-butyl carbamate is sourced from PubChem (CID 178029798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).