C29H29ClN2O5 — CID 178030565
4-[3-[[1-(4-chlorophenyl)-2-oxo-2-spiro[2H-indole-3,1'-cyclopropane]-1-ylethyl]amino]-5-methoxyphenoxy]butanoic acid (PubChem CID 178030565) has the molecular formula C29H29ClN2O5 and a molecular weight of 521.01 g/mol. Its IUPAC name is 4-[3-[[1-(4-chlorophenyl)-2-oxo-2-spiro[2H-indole-3,1'-cyclopropane]-1-ylethyl]amino]-5-methoxyphenoxy]butanoic acid.
| Compound Name | 4-[3-[[1-(4-chlorophenyl)-2-oxo-2-spiro[2H-indole-3,1'-cyclopropane]-1-ylethyl]amino]-5-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 178030565 |
| Molecular Formula | C29H29ClN2O5 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 4-[3-[[1-(4-chlorophenyl)-2-oxo-2-spiro[2H-indole-3,1'-cyclopropane]-1-ylethyl]amino]-5-methoxyphenoxy]butanoic acid |
| SMILES | COc1cc(NC(C(=O)N2CC3(CC3)c3ccccc32)c2ccc(Cl)cc2)cc(OCCCC(=O)O)c1 |
| InChI | InChI=1S/C29H29ClN2O5/c1-36-22-15-21(16-23(17-22)37-14-4-7-26(33)34)31-27(19-8-10-20(30)11-9-19)28(35)32-18-29(12-13-29)24-5-2-3-6-25(24)32/h2-3,5-6,8-11,15-17,27,31H,4,7,12-14,18H2,1H3,(H,33,34) |
| InChIKey | DYIVYNUMFYWWCS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|