C26H31ClN2O2 — CID 178031502
methyl 6-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]hexanoate (PubChem CID 178031502) has the molecular formula C26H31ClN2O2 and a molecular weight of 439.00 g/mol. Its IUPAC name is methyl 6-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]hexanoate.
| Compound Name | methyl 6-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 178031502 |
| Molecular Formula | C26H31ClN2O2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | methyl 6-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]hexanoate |
| SMILES | COC(=O)CCCCCN1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C26H31ClN2O2/c1-31-24(30)7-3-2-4-15-29-16-12-19(13-17-29)25-23-11-10-22(27)18-21(23)9-8-20-6-5-14-28-26(20)25/h5-6,10-11,14,18H,2-4,7-9,12-13,15-17H2,1H3 |
| InChIKey | SMJIOEXXXHUNBS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|