C32H32FN4O3P — CID 178032070
N-(1-tert-butylpyrazol-4-yl)-2-[3-fluoro-5-methyl-4-[6-[methyl(phenyl)phosphoryl]quinolin-4-yl]oxyphenyl]acetamide (PubChem CID 178032070) has the molecular formula C32H32FN4O3P and a molecular weight of 570.61 g/mol. Its IUPAC name is N-(1-tert-butylpyrazol-4-yl)-2-[3-fluoro-5-methyl-4-[6-[methyl(phenyl)phosphoryl]quinolin-4-yl]oxyphenyl]acetamide.
| Compound Name | N-(1-tert-butylpyrazol-4-yl)-2-[3-fluoro-5-methyl-4-[6-[methyl(phenyl)phosphoryl]quinolin-4-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 178032070 |
| Molecular Formula | C32H32FN4O3P |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | N-(1-tert-butylpyrazol-4-yl)-2-[3-fluoro-5-methyl-4-[6-[methyl(phenyl)phosphoryl]quinolin-4-yl]oxyphenyl]acetamide |
| SMILES | Cc1cc(CC(=O)Nc2cnn(C(C)(C)C)c2)cc(F)c1Oc1ccnc2ccc([P@@](C)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C32H32FN4O3P/c1-21-15-22(17-30(38)36-23-19-35-37(20-23)32(2,3)4)16-27(33)31(21)40-29-13-14-34-28-12-11-25(18-26(28)29)41(5,39)24-9-7-6-8-10-24/h6-16,18-20H,17H2,1-5H3,(H,36,38)/t41-/m0/s1 |
| InChIKey | RGMGGBPCILGCGD-RWYGWLOXSA-N |
| XLogP | 6.55 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|