C15H29BN4O — CID 178032891
CID 178032891 (PubChem CID 178032891) has the molecular formula C15H29BN4O and a molecular weight of 292.24 g/mol.
| Compound Name | CID 178032891 |
|---|---|
| PubChem CID | 178032891 |
| Molecular Formula | C15H29BN4O |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | — |
| SMILES | C[C@H](CN1CCCC1)NC(=O)c1ccnc(CN)c1.[B]C.[H][H].[H][H] |
| InChI | InChI=1S/C14H22N4O.CH3B.2H2/c1-11(10-18-6-2-3-7-18)17-14(19)12-4-5-16-13(8-12)9-15;1-2;;/h4-5,8,11H,2-3,6-7,9-10,15H2,1H3,(H,17,19);1H3;2*1H/t11-;;;/m1.../s1 |
| InChIKey | IBFVNEUFIATSOI-HCEFKKQBSA-N |
| XLogP | 1.45 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|