C19H20F3N3O2S — CID 178034160
1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea (PubChem CID 178034160) has the molecular formula C19H20F3N3O2S and a molecular weight of 411.45 g/mol. Its IUPAC name is 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea.
| Compound Name | 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea |
|---|---|
| PubChem CID | 178034160 |
| Molecular Formula | C19H20F3N3O2S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)CCc2ccc(SC(F)(F)F)cc21.NC(N)=O |
| InChI | InChI=1S/C18H16F3NOS.CH4N2O/c1-12(13-5-3-2-4-6-13)22-16-11-15(24-18(19,20)21)9-7-14(16)8-10-17(22)23;2-1(3)4/h2-7,9,11-12H,8,10H2,1H3;(H4,2,3,4)/t12-;/m0./s1 |
| InChIKey | DANCDMITZTVRKD-YDALLXLXSA-N |
| XLogP | 4.36 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |