About 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea
1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea (PubChem CID 178034160) has the molecular formula C19H20F3N3O2S
and a molecular weight of 411.45 g/mol. Its IUPAC name is 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea.
Molecular Properties
| Compound Name | 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea |
| PubChem CID | 178034160 |
| Molecular Formula | C19H20F3N3O2S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)CCc2ccc(SC(F)(F)F)cc21.NC(N)=O |
| InChI | InChI=1S/C18H16F3NOS.CH4N2O/c1-12(13-5-3-2-4-6-13)22-16-11-15(24-18(19,20)21)9-7-14(16)8-10-17(22)23;2-1(3)4/h2-7,9,11-12H,8,10H2,1H3;(H4,2,3,4)/t12-;/m0./s1 |
| InChIKey | DANCDMITZTVRKD-YDALLXLXSA-N |
| XLogP | 4.36 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea?
The IUPAC name of 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea (CID 178034160) is 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea.
What is the SMILES notation for 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea?
The canonical SMILES for 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea is C[C@@H](c1ccccc1)N1C(=O)CCc2ccc(SC(F)(F)F)cc21.NC(N)=O.
What is the InChIKey of 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea?
The InChIKey is DANCDMITZTVRKD-YDALLXLXSA-N. The full InChI is InChI=1S/C18H16F3NOS.CH4N2O/c1-12(13-5-3-2-4-6-13)22-16-11-15(24-18(19,20)21)9-7-14(16)8-10-17(22)23;2-1(3)4/h2-7,9,11-12H,8,10H2,1H3;(H4,2,3,4)/t12-;/m0./s1.
What are the key properties of 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea?
1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea has a molecular weight of 411.45 g/mol, XLogP of 4.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-1-phenylethyl]-7-(trifluoromethylsulfanyl)-3,4-dihydroquinolin-2-one;urea is sourced from PubChem (CID 178034160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).