About potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane
potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane (PubChem CID 178034658) has the molecular formula C13H30KN3
and a molecular weight of 267.50 g/mol. Its IUPAC name is potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane.
Molecular Properties
| Compound Name | potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane |
| PubChem CID | 178034658 |
| Molecular Formula | C13H30KN3 |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane |
| SMILES | CC.CCC1(CCN(C)C)CN(CC[NH-])C1.[K+] |
| InChI | InChI=1S/C11H24N3.C2H6.K/c1-4-11(5-7-13(2)3)9-14(10-11)8-6-12;1-2;/h12H,4-10H2,1-3H3;1-2H3;/q-1;;+1 |
| InChIKey | IRGALIHMRKQCNJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 30.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane?
The IUPAC name of potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane (CID 178034658) is potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane.
What is the SMILES notation for potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane?
The canonical SMILES for potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane is CC.CCC1(CCN(C)C)CN(CC[NH-])C1.[K+].
What is the InChIKey of potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane?
The InChIKey is IRGALIHMRKQCNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N3.C2H6.K/c1-4-11(5-7-13(2)3)9-14(10-11)8-6-12;1-2;/h12H,4-10H2,1-3H3;1-2H3;/q-1;;+1.
What are the key properties of potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane?
potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane has a molecular weight of 267.50 g/mol, XLogP of -0.27, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-[3-[2-(dimethylamino)ethyl]-3-ethylazetidin-1-yl]ethylazanide;ethane is sourced from PubChem (CID 178034658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).