C17H17F2N3O2 — CID 178034947
methyl 4-[2-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]benzoate (PubChem CID 178034947) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is methyl 4-[2-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]benzoate.
| Compound Name | methyl 4-[2-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]benzoate |
|---|---|
| PubChem CID | 178034947 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | methyl 4-[2-(4,4-difluoropiperidin-1-yl)pyrimidin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccnc(N3CCC(F)(F)CC3)n2)cc1 |
| InChI | InChI=1S/C17H17F2N3O2/c1-24-15(23)13-4-2-12(3-5-13)14-6-9-20-16(21-14)22-10-7-17(18,19)8-11-22/h2-6,9H,7-8,10-11H2,1H3 |
| InChIKey | YDJBETOKJAYZLO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |