About CID 178035238
CID 178035238 (PubChem CID 178035238) has the molecular formula C43H29BBr2F2N2-
and a molecular weight of 782.34 g/mol.
Molecular Properties
| Compound Name | CID 178035238 |
| PubChem CID | 178035238 |
| Molecular Formula | C43H29BBr2F2N2- |
| Molecular Weight | 782.34 g/mol |
| Exact Mass | 780.08 |
| IUPAC Name | — |
| SMILES | CC1c2cccc(c2)C2=CC(c3ccc(Br)cc3)=N/C2=C2/c3c1cccc3C(C)c1cccc(c1)-c1cc(-c3ccc(Br)cc3)n([B-](F)F)c12 |
| InChI | InChI=1S/C43H29BBr2F2N2/c1-24-28-6-3-8-30(20-28)36-22-38(26-12-16-32(45)17-13-26)49-42(36)41-40-34(24)10-5-11-35(40)25(2)29-7-4-9-31(21-29)37-23-39(50(43(37)41)44(47)48)27-14-18-33(46)19-15-27/h3-25H,1-2H3/q-1/b42-41- |
| InChIKey | QOGCAYRPKYDDNG-DYFOJMMBSA-N |
| XLogP | 12.40 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 782.34 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178035238 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178035238?
The IUPAC name of CID 178035238 (CID 178035238) is not available.
What is the SMILES notation for CID 178035238?
The canonical SMILES for CID 178035238 is CC1c2cccc(c2)C2=CC(c3ccc(Br)cc3)=N/C2=C2/c3c1cccc3C(C)c1cccc(c1)-c1cc(-c3ccc(Br)cc3)n([B-](F)F)c12.
What is the InChIKey of CID 178035238?
The InChIKey is QOGCAYRPKYDDNG-DYFOJMMBSA-N. The full InChI is InChI=1S/C43H29BBr2F2N2/c1-24-28-6-3-8-30(20-28)36-22-38(26-12-16-32(45)17-13-26)49-42(36)41-40-34(24)10-5-11-35(40)25(2)29-7-4-9-31(21-29)37-23-39(50(43(37)41)44(47)48)27-14-18-33(46)19-15-27/h3-25H,1-2H3/q-1/b42-41-.
What are the key properties of CID 178035238?
CID 178035238 has a molecular weight of 782.34 g/mol, XLogP of 12.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178035238 is sourced from PubChem (CID 178035238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).