C40H46F3NO2 — CID 178035264
ethane;14-(2-ethylhexyl)-18-prop-2-enyl-10-[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9(19),10,12(20),16-octaen-13-one (PubChem CID 178035264) has the molecular formula C40H46F3NO2 and a molecular weight of 629.81 g/mol. Its IUPAC name is ethane;14-(2-ethylhexyl)-18-prop-2-enyl-10-[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9(19),10,12(20),16-octaen-13-one.
| Compound Name | ethane;14-(2-ethylhexyl)-18-prop-2-enyl-10-[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9(19),10,12(20),16-octaen-13-one |
|---|---|
| PubChem CID | 178035264 |
| Molecular Formula | C40H46F3NO2 |
| Molecular Weight | 629.81 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | ethane;14-(2-ethylhexyl)-18-prop-2-enyl-10-[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9(19),10,12(20),16-octaen-13-one |
| SMILES | C=CCc1cc2c3c(cc(-c4ccc(C(F)(F)F)cc4)c4c3c1-c1ccccc1O4)C(=O)N(CC(CC)CCCC)C2.CC.CC |
| InChI | InChI=1S/C36H34F3NO2.2C2H6/c1-4-7-11-22(6-3)20-40-21-25-18-24(10-5-2)31-27-12-8-9-13-30(27)42-34-28(19-29(35(40)41)32(25)33(31)34)23-14-16-26(17-15-23)36(37,38)39;2*1-2/h5,8-9,12-19,22H,2,4,6-7,10-11,20-21H2,1,3H3;2*1-2H3 |
| InChIKey | ZBORLUMSZJMEOQ-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.81 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|