About cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone
cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone (PubChem CID 178036065) has the molecular formula C11H11F3N2O2
and a molecular weight of 260.21 g/mol. Its IUPAC name is cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone |
| PubChem CID | 178036065 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone |
| SMILES | C[C@@H](Oc1cc(C(=O)C2CC2)ncn1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O2/c1-6(11(12,13)14)18-9-4-8(15-5-16-9)10(17)7-2-3-7/h4-7H,2-3H2,1H3/t6-/m1/s1 |
| InChIKey | WUIKNVNMYIIEEW-ZCFIWIBFSA-N |
| XLogP | 2.40 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone?
The IUPAC name of cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone (CID 178036065) is cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone.
What is the SMILES notation for cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone?
The canonical SMILES for cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone is C[C@@H](Oc1cc(C(=O)C2CC2)ncn1)C(F)(F)F.
What is the InChIKey of cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone?
The InChIKey is WUIKNVNMYIIEEW-ZCFIWIBFSA-N. The full InChI is InChI=1S/C11H11F3N2O2/c1-6(11(12,13)14)18-9-4-8(15-5-16-9)10(17)7-2-3-7/h4-7H,2-3H2,1H3/t6-/m1/s1.
What are the key properties of cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone?
cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone has a molecular weight of 260.21 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[6-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]methanone is sourced from PubChem (CID 178036065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).