C18H26N4S2 — CID 178037080
(E)-N,3-dimethyl-2-(1,2-thiazol-5-yl)pent-2-en-1-amine;5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2-thiazole (PubChem CID 178037080) has the molecular formula C18H26N4S2 and a molecular weight of 362.57 g/mol. Its IUPAC name is (E)-N,3-dimethyl-2-(1,2-thiazol-5-yl)pent-2-en-1-amine;5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2-thiazole.
| Compound Name | (E)-N,3-dimethyl-2-(1,2-thiazol-5-yl)pent-2-en-1-amine;5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 178037080 |
| Molecular Formula | C18H26N4S2 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (E)-N,3-dimethyl-2-(1,2-thiazol-5-yl)pent-2-en-1-amine;5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2-thiazole |
| SMILES | C1=C(c2ccns2)CNCC1.CC/C(C)=C(\CNC)c1ccns1 |
| InChI | InChI=1S/C10H16N2S.C8H10N2S/c1-4-8(2)9(7-11-3)10-5-6-12-13-10;1-2-7(6-9-4-1)8-3-5-10-11-8/h5-6,11H,4,7H2,1-3H3;2-3,5,9H,1,4,6H2/b9-8+; |
| InChIKey | HEIFKFNSCLAFOJ-HRNDJLQDSA-N |
| XLogP | 4.07 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |