C8H15N3O — CID 178037123
(Z,2E)-4-amino-2-(aminomethylidene)-N-propan-2-ylbut-3-enamide (PubChem CID 178037123) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is (Z,2E)-4-amino-2-(aminomethylidene)-N-propan-2-ylbut-3-enamide.
| Compound Name | (Z,2E)-4-amino-2-(aminomethylidene)-N-propan-2-ylbut-3-enamide |
|---|---|
| PubChem CID | 178037123 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (Z,2E)-4-amino-2-(aminomethylidene)-N-propan-2-ylbut-3-enamide |
| SMILES | CC(C)NC(=O)C(/C=C\N)=C/N |
| InChI | InChI=1S/C8H15N3O/c1-6(2)11-8(12)7(5-10)3-4-9/h3-6H,9-10H2,1-2H3,(H,11,12)/b4-3-,7-5+ |
| InChIKey | XKZFDMIMAOBOLA-QVXLNCAUSA-N |
| XLogP | -0.17 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|